C23H25ClN6O2 — CID 87191787
(2R)-N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 87191787) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is (2R)-N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87191787 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2R)-N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)NC2CCC(Nc3cc(-c4c[nH]c5ncccc45)cc(Cl)n3)CC2)N1 |
| InChI | InChI=1S/C23H25ClN6O2/c24-19-10-13(17-12-26-22-16(17)2-1-9-25-22)11-20(30-19)27-14-3-5-15(6-4-14)28-23(32)18-7-8-21(31)29-18/h1-2,9-12,14-15,18H,3-8H2,(H,25,26)(H,27,30)(H,28,32)(H,29,31)/t14?,15?,18-/m1/s1 |
| InChIKey | KBWIHMOACJCHEL-JTTJXQCZSA-N |
| XLogP | 3.40 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|