C24H29ClN6O — CID 87191347
N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]piperidine-3-carboxamide (PubChem CID 87191347) has the molecular formula C24H29ClN6O and a molecular weight of 452.99 g/mol. Its IUPAC name is N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]piperidine-3-carboxamide.
| Compound Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87191347 |
| Molecular Formula | C24H29ClN6O |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)C1)C1CCCNC1 |
| InChI | InChI=1S/C24H29ClN6O/c25-21-10-16(20-14-28-23-19(20)7-3-9-27-23)11-22(31-21)29-17-5-1-6-18(12-17)30-24(32)15-4-2-8-26-13-15/h3,7,9-11,14-15,17-18,26H,1-2,4-6,8,12-13H2,(H,27,28)(H,29,31)(H,30,32) |
| InChIKey | FMYIMCAXPYEISO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|