C24H25ClN6 — CID 50939067
1-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-3-N-(pyridin-3-ylmethyl)cyclohexane-1,3-diamine (PubChem CID 50939067) has the molecular formula C24H25ClN6 and a molecular weight of 432.96 g/mol. Its IUPAC name is 1-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-3-N-(pyridin-3-ylmethyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-3-N-(pyridin-3-ylmethyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 50939067 |
| Molecular Formula | C24H25ClN6 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-N-[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]-3-N-(pyridin-3-ylmethyl)cyclohexane-1,3-diamine |
| SMILES | Clc1cc(-c2c[nH]c3ncccc23)cc(NC2CCCC(NCc3cccnc3)C2)n1 |
| InChI | InChI=1S/C24H25ClN6/c25-22-10-17(21-15-29-24-20(21)7-3-9-27-24)11-23(31-22)30-19-6-1-5-18(12-19)28-14-16-4-2-8-26-13-16/h2-4,7-11,13,15,18-19,28H,1,5-6,12,14H2,(H,27,29)(H,30,31) |
| InChIKey | FJRDUXFOOXTQHZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|