C22H25ClN6O — CID 140560323
N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]azetidine-2-carboxamide (PubChem CID 140560323) has the molecular formula C22H25ClN6O and a molecular weight of 424.94 g/mol. Its IUPAC name is N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]azetidine-2-carboxamide.
| Compound Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 140560323 |
| Molecular Formula | C22H25ClN6O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]azetidine-2-carboxamide |
| SMILES | O=C(NC1CCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)CC1)C1CCN1 |
| InChI | InChI=1S/C22H25ClN6O/c23-19-10-13(17-12-26-21-16(17)2-1-8-25-21)11-20(29-19)27-14-3-5-15(6-4-14)28-22(30)18-7-9-24-18/h1-2,8,10-12,14-15,18,24H,3-7,9H2,(H,25,26)(H,27,29)(H,28,30) |
| InChIKey | RSMXULQRENUDRU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|