C23H28ClN5 — CID 87191931
6-chloro-N-(3-piperidin-1-ylcyclohexyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191931) has the molecular formula C23H28ClN5 and a molecular weight of 409.97 g/mol. Its IUPAC name is 6-chloro-N-(3-piperidin-1-ylcyclohexyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3-piperidin-1-ylcyclohexyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191931 |
| Molecular Formula | C23H28ClN5 |
| Molecular Weight | 409.97 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 6-chloro-N-(3-piperidin-1-ylcyclohexyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | Clc1cc(-c2c[nH]c3ncccc23)cc(NC2CCCC(N3CCCCC3)C2)n1 |
| InChI | InChI=1S/C23H28ClN5/c24-21-12-16(20-15-26-23-19(20)8-5-9-25-23)13-22(28-21)27-17-6-4-7-18(14-17)29-10-2-1-3-11-29/h5,8-9,12-13,15,17-18H,1-4,6-7,10-11,14H2,(H,25,26)(H,27,28) |
| InChIKey | FZFKJVOWCGZMBZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|