C21H25ClN6O — CID 87192255
N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(methylamino)acetamide (PubChem CID 87192255) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(methylamino)acetamide.
| Compound Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 87192255 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NC1CCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)CC1 |
| InChI | InChI=1S/C21H25ClN6O/c1-23-12-20(29)27-15-6-4-14(5-7-15)26-19-10-13(9-18(22)28-19)17-11-25-21-16(17)3-2-8-24-21/h2-3,8-11,14-15,23H,4-7,12H2,1H3,(H,24,25)(H,26,28)(H,27,29) |
| InChIKey | JNAPIMRRTSLJPS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|