C25H31ClN6O — CID 87192364
1-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]piperidin-1-yl]ethanone (PubChem CID 87192364) has the molecular formula C25H31ClN6O and a molecular weight of 467.02 g/mol. Its IUPAC name is 1-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 87192364 |
| Molecular Formula | C25H31ClN6O |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 1-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NC2CCC(Nc3cc(-c4c[nH]c5ncccc45)cc(Cl)n3)CC2)CC1 |
| InChI | InChI=1S/C25H31ClN6O/c1-16(33)32-11-8-20(9-12-32)29-18-4-6-19(7-5-18)30-24-14-17(13-23(26)31-24)22-15-28-25-21(22)3-2-10-27-25/h2-3,10,13-15,18-20,29H,4-9,11-12H2,1H3,(H,27,28)(H,30,31) |
| InChIKey | AMWMRSYYVFHGJI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|