C22H18ClN5 — CID 87191184
6-chloro-N-[2-(1H-indol-3-yl)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191184) has the molecular formula C22H18ClN5 and a molecular weight of 387.87 g/mol. Its IUPAC name is 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191184 |
| Molecular Formula | C22H18ClN5 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | Clc1cc(-c2c[nH]c3ncccc23)cc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C22H18ClN5/c23-20-10-15(18-13-27-22-17(18)5-3-8-25-22)11-21(28-20)24-9-7-14-12-26-19-6-2-1-4-16(14)19/h1-6,8,10-13,26H,7,9H2,(H,24,28)(H,25,27) |
| InChIKey | PQTKCFKJPLYACE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|