C23H25N5O — CID 112880267
6-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880267) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 6-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880267 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 6-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(NCCc2c[nH]c3ccccc23)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H25N5O/c1-29-14-13-25-22-15-21(27-23(28-22)17-7-3-2-4-8-17)24-12-11-18-16-26-20-10-6-5-9-19(18)20/h2-10,15-16,26H,11-14H2,1H3,(H2,24,25,27,28) |
| InChIKey | GREXEXBSNVFQFO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|