C19H22N6O — CID 155536111
2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 155536111) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155536111 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(NCCc2c[nH]c3ccccc23)nc2[nH]ccc12 |
| InChI | InChI=1S/C19H22N6O/c1-26-11-10-21-18-15-7-9-20-17(15)24-19(25-18)22-8-6-13-12-23-16-5-3-2-4-14(13)16/h2-5,7,9,12,23H,6,8,10-11H2,1H3,(H3,20,21,22,24,25) |
| InChIKey | KGNJNYVITCWPNS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|