C22H25N5 — CID 146598297
2-N-butan-2-yl-4-N-[2-(1H-indol-3-yl)ethyl]quinazoline-2,4-diamine (PubChem CID 146598297) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-N-butan-2-yl-4-N-[2-(1H-indol-3-yl)ethyl]quinazoline-2,4-diamine.
| Compound Name | 2-N-butan-2-yl-4-N-[2-(1H-indol-3-yl)ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 146598297 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-N-butan-2-yl-4-N-[2-(1H-indol-3-yl)ethyl]quinazoline-2,4-diamine |
| SMILES | CCC(C)Nc1nc(NCCc2c[nH]c3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C22H25N5/c1-3-15(2)25-22-26-20-11-7-5-9-18(20)21(27-22)23-13-12-16-14-24-19-10-6-4-8-17(16)19/h4-11,14-15,24H,3,12-13H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | SEPDPFCAQZACLZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |