C17H19ClN4O — CID 135376643
6-chloro-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxypyrimidin-4-amine (PubChem CID 135376643) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxypyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 135376643 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-chloro-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxypyrimidin-4-amine |
| SMILES | CC(C)Oc1nc(Cl)cc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C17H19ClN4O/c1-11(2)23-17-21-15(18)9-16(22-17)19-8-7-12-10-20-14-6-4-3-5-13(12)14/h3-6,9-11,20H,7-8H2,1-2H3,(H,19,21,22) |
| InChIKey | DXESLYBDVVUNJF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |