C22H22ClN5O2S — CID 87191584
6-chloro-N-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191584) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 6-chloro-N-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191584 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 6-chloro-N-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | OS1(O)CCN(c2ccc(Nc3cc(-c4c[nH]c5ncccc45)cc(Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C22H22ClN5O2S/c23-20-12-15(19-14-25-22-18(19)2-1-7-24-22)13-21(27-20)26-16-3-5-17(6-4-16)28-8-10-31(29,30)11-9-28/h1-7,12-14,29-30H,8-11H2,(H,24,25)(H,26,27) |
| InChIKey | MYROPGHJLVKGNA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|