C22H18N4 — CID 139197585
3-[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 139197585) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 139197585 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[4-[bis(1H-pyrrol-2-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1c[nH]c(C(c2ccc(-c3c[nH]c4ncccc34)cc2)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C22H18N4/c1-4-17-18(14-26-22(17)25-13-1)15-7-9-16(10-8-15)21(19-5-2-11-23-19)20-6-3-12-24-20/h1-14,21,23-24H,(H,25,26) |
| InChIKey | RAPPPQYLHJYLAF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |