C23H19N5O — CID 175604579
2-phenyl-2-[[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-yl]amino]ethanol (PubChem CID 175604579) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-phenyl-2-[[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-yl]amino]ethanol.
| Compound Name | 2-phenyl-2-[[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 175604579 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-phenyl-2-[[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-yl]amino]ethanol |
| SMILES | OCC(Nc1ncnc2ccc(-c3c[nH]c4ncccc34)cc12)c1ccccc1 |
| InChI | InChI=1S/C23H19N5O/c29-13-21(15-5-2-1-3-6-15)28-23-18-11-16(8-9-20(18)26-14-27-23)19-12-25-22-17(19)7-4-10-24-22/h1-12,14,21,29H,13H2,(H,24,25)(H,26,27,28) |
| InChIKey | OYVBBBNYTNSCKF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |