C16H14N2 — CID 143384633
3-(4-ethenyl-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143384633) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-(4-ethenyl-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(4-ethenyl-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143384633 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-(4-ethenyl-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=Cc1ccc(-c2c[nH]c3ncccc23)cc1C |
| InChI | InChI=1S/C16H14N2/c1-3-12-6-7-13(9-11(12)2)15-10-18-16-14(15)5-4-8-17-16/h3-10H,1H2,2H3,(H,17,18) |
| InChIKey | RCRNYYBMOYCKCC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |