C8H8N2 — CID 101366417
3-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 101366417) has the molecular formula C8H8N2 and a molecular weight of 135.18 g/mol. Its IUPAC name is 3-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 101366417 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 135.18 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H8N2/c1-6-5-10-8-7(6)3-2-4-9-8/h2-5H,1H3,(H,9,10)/i1D3 |
| InChIKey | PKZDPOGLGBWEGP-FIBGUPNXSA-N |
| XLogP | 1.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |