C11H19N3 — CID 142426313
ethane;1H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 142426313) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;1H-pyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | ethane;1H-pyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 142426313 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;1H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | CC.CC.Nc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C7H7N3.2C2H6/c8-6-4-10-7-5(6)2-1-3-9-7;2*1-2/h1-4H,8H2,(H,9,10);2*1-2H3 |
| InChIKey | FROUTKOWSSEUOO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |