About 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol (PubChem CID 66932650) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol |
| PubChem CID | 66932650 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol |
| SMILES | NC(CO)Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C10H13N3O/c11-8(6-14)4-7-5-13-10-9(7)2-1-3-12-10/h1-3,5,8,14H,4,6,11H2,(H,12,13) |
| InChIKey | AMMAIBNVQSTRKZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol?
The IUPAC name of 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol (CID 66932650) is 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol.
What is the SMILES notation for 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol?
The canonical SMILES for 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol is NC(CO)Cc1c[nH]c2ncccc12.
What is the InChIKey of 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol?
The InChIKey is AMMAIBNVQSTRKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c11-8(6-14)4-7-5-13-10-9(7)2-1-3-12-10/h1-3,5,8,14H,4,6,11H2,(H,12,13).
What are the key properties of 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol?
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol has a molecular weight of 191.23 g/mol, XLogP of 0.43, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-ol is sourced from PubChem (CID 66932650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).