C11H12N2 — CID 142204589
3-[(Z)-but-2-enyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 142204589) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-[(Z)-but-2-enyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(Z)-but-2-enyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142204589 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-[(Z)-but-2-enyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C/C=C\Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C11H12N2/c1-2-3-5-9-8-13-11-10(9)6-4-7-12-11/h2-4,6-8H,5H2,1H3,(H,12,13)/b3-2- |
| InChIKey | UFSJZQWOFWKHEG-IHWYPQMZSA-N |
| XLogP | 2.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|