C15H14N2 — CID 58086816
3-[(3-methylphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58086816) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-[(3-methylphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(3-methylphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58086816 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-[(3-methylphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cccc(Cc2c[nH]c3ncccc23)c1 |
| InChI | InChI=1S/C15H14N2/c1-11-4-2-5-12(8-11)9-13-10-17-15-14(13)6-3-7-16-15/h2-8,10H,9H2,1H3,(H,16,17) |
| InChIKey | PNLYDAOYIOMWTR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |