C11H13N3 — CID 91517846
ethane;2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetonitrile (PubChem CID 91517846) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is ethane;2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetonitrile.
| Compound Name | ethane;2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 91517846 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | ethane;2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetonitrile |
| SMILES | CC.N#CCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C9H7N3.C2H6/c10-4-3-7-6-12-9-8(7)2-1-5-11-9;1-2/h1-2,5-6H,3H2,(H,11,12);1-2H3 |
| InChIKey | LJSHKIBSQCBLLL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |