C12H15BrN2 — CID 59362853
3-(5-bromopentyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59362853) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 3-(5-bromopentyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(5-bromopentyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59362853 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(5-bromopentyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | BrCCCCCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H15BrN2/c13-7-3-1-2-5-10-9-15-12-11(10)6-4-8-14-12/h4,6,8-9H,1-3,5,7H2,(H,14,15) |
| InChIKey | NMSOXTOIKVDZMC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|