C15H15N3O2S — CID 53144795
N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]benzenesulfonamide (PubChem CID 53144795) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53144795 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1c[nH]c2ncccc12)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O2S/c19-21(20,13-5-2-1-3-6-13)18-10-8-12-11-17-15-14(12)7-4-9-16-15/h1-7,9,11,18H,8,10H2,(H,16,17) |
| InChIKey | AWMZHHRWUSWUJL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |