C8H7N5 — CID 86671429
3-(azidomethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 86671429) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-(azidomethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(azidomethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 86671429 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-(azidomethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [N-]=[N+]=NCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H7N5/c9-13-12-5-6-4-11-8-7(6)2-1-3-10-8/h1-4H,5H2,(H,10,11) |
| InChIKey | BNCJWUFMTTWDJV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|