About 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol
3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol (PubChem CID 159555416) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol.
Molecular Properties
| Compound Name | 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol |
| PubChem CID | 159555416 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol |
| SMILES | OCc1c[nH]c2ccccc12.[N-]=[N+]=NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H8N4.C9H9NO/c10-13-12-6-7-5-11-9-4-2-1-3-8(7)9;11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,11H,6H2;1-5,10-11H,6H2 |
| InChIKey | MFXSNRUMADROPO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol?
The IUPAC name of 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol (CID 159555416) is 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol.
What is the SMILES notation for 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol?
The canonical SMILES for 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol is OCc1c[nH]c2ccccc12.[N-]=[N+]=NCc1c[nH]c2ccccc12.
What is the InChIKey of 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol?
The InChIKey is MFXSNRUMADROPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4.C9H9NO/c10-13-12-6-7-5-11-9-4-2-1-3-8(7)9;11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,11H,6H2;1-5,10-11H,6H2.
What are the key properties of 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol?
3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol has a molecular weight of 319.37 g/mol, XLogP of 4.64, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azidomethyl)-1H-indole;1H-indol-3-ylmethanol is sourced from PubChem (CID 159555416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).