C13H11N2- — CID 91928260
3-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 91928260) has the molecular formula C13H11N2- and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 91928260 |
| Molecular Formula | C13H11N2- |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(cyclopenta-1,4-dien-1-ylmethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2[nH]cc(Cc3cc[cH-]c3)c2c1 |
| InChI | InChI=1S/C13H11N2/c1-2-5-10(4-1)8-11-9-15-13-12(11)6-3-7-14-13/h1-7,9H,8H2,(H,14,15)/q-1 |
| InChIKey | UVDHITWMYZIEKD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|