C14H13N3 — CID 59362788
3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline (PubChem CID 59362788) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 59362788 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
| SMILES | Nc1cccc(Cc2c[nH]c3ncccc23)c1 |
| InChI | InChI=1S/C14H13N3/c15-12-4-1-3-10(8-12)7-11-9-17-14-13(11)5-2-6-16-14/h1-6,8-9H,7,15H2,(H,16,17) |
| InChIKey | DBYWQFPEZKVDOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|