C8H5N5O — CID 146591530
1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide (PubChem CID 146591530) has the molecular formula C8H5N5O and a molecular weight of 187.16 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide.
| Compound Name | 1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide |
|---|---|
| PubChem CID | 146591530 |
| Molecular Formula | C8H5N5O |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H5N5O/c9-13-12-8(14)6-4-11-7-5(6)2-1-3-10-7/h1-4H,(H,10,11) |
| InChIKey | YVRTZPJTEDZWQR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|