C8H4FN5O — CID 146591499
5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide (PubChem CID 146591499) has the molecular formula C8H4FN5O and a molecular weight of 205.15 g/mol. Its IUPAC name is 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide.
| Compound Name | 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide |
|---|---|
| PubChem CID | 146591499 |
| Molecular Formula | C8H4FN5O |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1c[nH]c2ncc(F)cc12 |
| InChI | InChI=1S/C8H4FN5O/c9-4-1-5-6(8(15)13-14-10)3-12-7(5)11-2-4/h1-3H,(H,11,12) |
| InChIKey | MSLBKDDHRHGWNQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|