About ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine
ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 144524176) has the molecular formula C13H12F2N4
and a molecular weight of 262.26 g/mol. Its IUPAC name is ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 144524176 |
| Molecular Formula | C13H12F2N4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC.Fc1cnc(-c2c[nH]c3ncc(F)cc23)nc1 |
| InChI | InChI=1S/C11H6F2N4.C2H6/c12-6-1-8-9(5-17-10(8)14-2-6)11-15-3-7(13)4-16-11;1-2/h1-5H,(H,14,17);1-2H3 |
| InChIKey | HWYSLLQIFOSBGM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine (CID 144524176) is ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine is CC.Fc1cnc(-c2c[nH]c3ncc(F)cc23)nc1.
What is the InChIKey of ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is HWYSLLQIFOSBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N4.C2H6/c12-6-1-8-9(5-17-10(8)14-2-6)11-15-3-7(13)4-16-11;1-2/h1-5H,(H,14,17);1-2H3.
What are the key properties of ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine?
ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 262.26 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-3-(5-fluoropyrimidin-2-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 144524176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).