C9H8N2O2 — CID 123135084
1-(5-hydroxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 123135084) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-(5-hydroxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
| Compound Name | 1-(5-hydroxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 123135084 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1-(5-hydroxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2ncc(O)cc12 |
| InChI | InChI=1S/C9H8N2O2/c1-5(12)8-4-11-9-7(8)2-6(13)3-10-9/h2-4,13H,1H3,(H,10,11) |
| InChIKey | HNGWDOFDNMWMNY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |