C18H18N4O3 — CID 11313743
5-benzamido-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 11313743) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 5-benzamido-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-benzamido-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11313743 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-benzamido-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]c2ncc(NC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C18H18N4O3/c1-25-8-7-19-18(24)15-11-21-16-14(15)9-13(10-20-16)22-17(23)12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | XJMNKULOWHGQIA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|