C17H24N4O3 — CID 11232835
5-(3,3-dimethylbutanoylamino)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 11232835) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-(3,3-dimethylbutanoylamino)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-(3,3-dimethylbutanoylamino)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11232835 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-(3,3-dimethylbutanoylamino)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]c2ncc(NC(=O)CC(C)(C)C)cc12 |
| InChI | InChI=1S/C17H24N4O3/c1-17(2,3)8-14(22)21-11-7-12-13(10-20-15(12)19-9-11)16(23)18-5-6-24-4/h7,9-10H,5-6,8H2,1-4H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | SHWZYVVPXSFCHT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|