C19H17F3N4O3 — CID 11418316
N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 11418316) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11418316 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]c2ncc(NC(=O)c3cccc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C19H17F3N4O3/c1-29-6-5-23-18(28)15-10-25-16-14(15)8-13(9-24-16)26-17(27)11-3-2-4-12(7-11)19(20,21)22/h2-4,7-10H,5-6H2,1H3,(H,23,28)(H,24,25)(H,26,27) |
| InChIKey | IFDIMGKVYLXXEV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|