C14H12BF3N2O3 — CID 153485953
[2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]-3-pyridinyl]boronic acid (PubChem CID 153485953) has the molecular formula C14H12BF3N2O3 and a molecular weight of 324.07 g/mol. Its IUPAC name is [2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]-3-pyridinyl]boronic acid.
| Compound Name | [2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 153485953 |
| Molecular Formula | C14H12BF3N2O3 |
| Molecular Weight | 324.07 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]-3-pyridinyl]boronic acid |
| SMILES | Cc1ncc(NC(=O)c2cccc(C(F)(F)F)c2)cc1B(O)O |
| InChI | InChI=1S/C14H12BF3N2O3/c1-8-12(15(22)23)6-11(7-19-8)20-13(21)9-3-2-4-10(5-9)14(16,17)18/h2-7,22-23H,1H3,(H,20,21) |
| InChIKey | MNWIUGMAHQVCLZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.07 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|