C21H18F4N4O — CID 154684237
N-[5-[5-(dimethylamino)-6-fluoro-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide (PubChem CID 154684237) has the molecular formula C21H18F4N4O and a molecular weight of 418.39 g/mol. Its IUPAC name is N-[5-[5-(dimethylamino)-6-fluoro-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[5-(dimethylamino)-6-fluoro-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154684237 |
| Molecular Formula | C21H18F4N4O |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[5-[5-(dimethylamino)-6-fluoro-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ncc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1cnc(F)c(N(C)C)c1 |
| InChI | InChI=1S/C21H18F4N4O/c1-12-17(14-8-18(29(2)3)19(22)27-10-14)9-16(11-26-12)28-20(30)13-5-4-6-15(7-13)21(23,24)25/h4-11H,1-3H3,(H,28,30) |
| InChIKey | KSTLBNMFTNRCOV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|