C27H25F3N4O3 — CID 135390019
N-[5-(6-but-3-ynoxy-5-morpholin-4-yl-3-pyridinyl)-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide (PubChem CID 135390019) has the molecular formula C27H25F3N4O3 and a molecular weight of 510.52 g/mol. Its IUPAC name is N-[5-(6-but-3-ynoxy-5-morpholin-4-yl-3-pyridinyl)-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-(6-but-3-ynoxy-5-morpholin-4-yl-3-pyridinyl)-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135390019 |
| Molecular Formula | C27H25F3N4O3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[5-(6-but-3-ynoxy-5-morpholin-4-yl-3-pyridinyl)-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| SMILES | C#CCCOc1ncc(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)cnc2C)cc1N1CCOCC1 |
| InChI | InChI=1S/C27H25F3N4O3/c1-3-4-10-37-26-24(34-8-11-36-12-9-34)14-20(16-32-26)23-15-22(17-31-18(23)2)33-25(35)19-6-5-7-21(13-19)27(28,29)30/h1,5-7,13-17H,4,8-12H2,2H3,(H,33,35) |
| InChIKey | UCWTZYMAGASYNW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|