C35H36BrF3N4O6 — CID 146502149
N-[5-[6-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenoxy]-5-morpholin-4-yl-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide (PubChem CID 146502149) has the molecular formula C35H36BrF3N4O6 and a molecular weight of 745.59 g/mol. Its IUPAC name is N-[5-[6-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenoxy]-5-morpholin-4-yl-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[6-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenoxy]-5-morpholin-4-yl-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146502149 |
| Molecular Formula | C35H36BrF3N4O6 |
| Molecular Weight | 745.59 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | N-[5-[6-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenoxy]-5-morpholin-4-yl-3-pyridinyl]-6-methyl-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ncc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1cnc(Oc2ccc(OCCOCCOCCBr)cc2)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C35H36BrF3N4O6/c1-24-31(21-28(23-40-24)42-33(44)25-3-2-4-27(19-25)35(37,38)39)26-20-32(43-10-13-46-14-11-43)34(41-22-26)49-30-7-5-29(6-8-30)48-18-17-47-16-15-45-12-9-36/h2-8,19-23H,9-18H2,1H3,(H,42,44) |
| InChIKey | ANAFSGCPVNQWLS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|