C33H36F3N3O6 — CID 135390522
N-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 135390522) has the molecular formula C33H36F3N3O6 and a molecular weight of 627.66 g/mol. Its IUPAC name is N-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135390522 |
| Molecular Formula | C33H36F3N3O6 |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | N-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | C#CCOCCOCCOCCOc1ncc(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)cc1N1CCOCC1 |
| InChI | InChI=1S/C33H36F3N3O6/c1-3-11-41-14-15-43-16-17-44-18-19-45-32-30(39-9-12-42-13-10-39)21-26(23-37-32)29-22-28(8-7-24(29)2)38-31(40)25-5-4-6-27(20-25)33(34,35)36/h1,4-8,20-23H,9-19H2,2H3,(H,38,40) |
| InChIKey | WNOANVVCCAOHIX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|