C34H37F3N2O6 — CID 159771543
2-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 159771543) has the molecular formula C34H37F3N2O6 and a molecular weight of 626.67 g/mol. Its IUPAC name is 2-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 159771543 |
| Molecular Formula | C34H37F3N2O6 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 2-[4-methyl-3-[5-morpholin-4-yl-6-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | C#CCOCCOCCOCCOc1ncc(-c2cc(CC(=O)c3cccc(C(F)(F)F)c3)ccc2C)cc1N1CCOCC1 |
| InChI | InChI=1S/C34H37F3N2O6/c1-3-11-41-14-15-43-16-17-44-18-19-45-33-31(39-9-12-42-13-10-39)23-28(24-38-33)30-20-26(8-7-25(30)2)21-32(40)27-5-4-6-29(22-27)34(35,36)37/h1,4-8,20,22-24H,9-19,21H2,2H3 |
| InChIKey | UBJRCHHGXJVOAV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|