C32H36F3N3O3 — CID 142464641
ethane;N-[3-(6-hex-5-ynoxy-5-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 142464641) has the molecular formula C32H36F3N3O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is ethane;N-[3-(6-hex-5-ynoxy-5-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | ethane;N-[3-(6-hex-5-ynoxy-5-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142464641 |
| Molecular Formula | C32H36F3N3O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | ethane;N-[3-(6-hex-5-ynoxy-5-morpholin-4-yl-3-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | C#CCCCCOc1ncc(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)cc1N1CCOCC1.CC |
| InChI | InChI=1S/C30H30F3N3O3.C2H6/c1-3-4-5-6-14-39-29-27(36-12-15-38-16-13-36)18-23(20-34-29)26-19-25(11-10-21(26)2)35-28(37)22-8-7-9-24(17-22)30(31,32)33;1-2/h1,7-11,17-20H,4-6,12-16H2,2H3,(H,35,37);1-2H3 |
| InChIKey | QIHGINSLVZGSRH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|