C26H24N4O2 — CID 71001378
N-[3-[(E)-3-[benzyl(ethyl)amino]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 71001378) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[3-[(E)-3-[benzyl(ethyl)amino]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | N-[3-[(E)-3-[benzyl(ethyl)amino]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 71001378 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[3-[(E)-3-[benzyl(ethyl)amino]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | CCN(Cc1ccccc1)C(=O)/C=C/c1c[nH]c2ncc(NC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C26H24N4O2/c1-2-30(18-19-9-5-3-6-10-19)24(31)14-13-21-16-27-25-23(21)15-22(17-28-25)29-26(32)20-11-7-4-8-12-20/h3-17H,2,18H2,1H3,(H,27,28)(H,29,32)/b14-13+ |
| InChIKey | KNQLGEUHJLLGAQ-BUHFOSPRSA-N |
| XLogP | 4.88 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|