C28H22N4O2 — CID 69374205
(E)-3-[5-[(2-naphthalen-2-ylacetyl)amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide (PubChem CID 69374205) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is (E)-3-[5-[(2-naphthalen-2-ylacetyl)amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-[5-[(2-naphthalen-2-ylacetyl)amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69374205 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (E)-3-[5-[(2-naphthalen-2-ylacetyl)amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)/C(=C/c1c[nH]c2ncc(NC(=O)Cc3ccc4ccccc4c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O2/c29-27(34)24(20-7-2-1-3-8-20)14-22-16-30-28-25(22)15-23(17-31-28)32-26(33)13-18-10-11-19-6-4-5-9-21(19)12-18/h1-12,14-17H,13H2,(H2,29,34)(H,30,31)(H,32,33)/b24-14+ |
| InChIKey | NRSHYVIQSPVQPN-ZVHZXABRSA-N |
| XLogP | 4.92 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|