C21H22N4O3 — CID 69377566
tert-butyl N-[3-(3-amino-3-oxo-2-phenylprop-1-enyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate (PubChem CID 69377566) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is tert-butyl N-[3-(3-amino-3-oxo-2-phenylprop-1-enyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[3-(3-amino-3-oxo-2-phenylprop-1-enyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 69377566 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | tert-butyl N-[3-(3-amino-3-oxo-2-phenylprop-1-enyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc2[nH]cc(C=C(C(N)=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H22N4O3/c1-21(2,3)28-20(27)25-15-10-17-14(11-23-19(17)24-12-15)9-16(18(22)26)13-7-5-4-6-8-13/h4-12H,1-3H3,(H2,22,26)(H,23,24)(H,25,27) |
| InChIKey | DOJNKTFOXUGTOK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|