C22H17N3O4S — CID 69374843
(Z)-3-[5-(benzenesulfonamido)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enoic acid (PubChem CID 69374843) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is (Z)-3-[5-(benzenesulfonamido)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-[5-(benzenesulfonamido)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 69374843 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (Z)-3-[5-(benzenesulfonamido)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1c[nH]c2ncc(NS(=O)(=O)c3ccccc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O4S/c26-22(27)20(15-7-3-1-4-8-15)11-16-13-23-21-19(16)12-17(14-24-21)25-30(28,29)18-9-5-2-6-10-18/h1-14,25H,(H,23,24)(H,26,27)/b20-11- |
| InChIKey | LPSAFQGJOIBIJB-JAIQZWGSSA-N |
| XLogP | 3.99 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|