C18H16N4O2 — CID 69376484
3-(5-acetamido-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-phenylprop-2-enamide (PubChem CID 69376484) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-(5-acetamido-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-phenylprop-2-enamide.
| Compound Name | 3-(5-acetamido-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69376484 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-(5-acetamido-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-phenylprop-2-enamide |
| SMILES | CC(=O)Nc1cnc2[nH]cc(C=C(C(N)=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C18H16N4O2/c1-11(23)22-14-8-16-13(9-20-18(16)21-10-14)7-15(17(19)24)12-5-3-2-4-6-12/h2-10H,1H3,(H2,19,24)(H,20,21)(H,22,23) |
| InChIKey | KXRHOJOSPITLJE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|