C21H20N4O3 — CID 69377179
(Z)-2-phenyl-3-[5-(pyrrolidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 69377179) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (Z)-2-phenyl-3-[5-(pyrrolidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-phenyl-3-[5-(pyrrolidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69377179 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (Z)-2-phenyl-3-[5-(pyrrolidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1c[nH]c2ncc(NC(=O)N3CCCC3)cc12)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O3/c26-20(27)18(14-6-2-1-3-7-14)10-15-12-22-19-17(15)11-16(13-23-19)24-21(28)25-8-4-5-9-25/h1-3,6-7,10-13H,4-5,8-9H2,(H,22,23)(H,24,28)(H,26,27)/b18-10- |
| InChIKey | WGNFHKBAGHOQPV-ZDLGFXPLSA-N |
| XLogP | 3.82 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|