C18H15N3O3 — CID 69374897
2-(4-acetamidophenyl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid (PubChem CID 69374897) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | 2-(4-acetamidophenyl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69374897 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(4-acetamidophenyl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid |
| SMILES | CC(=O)Nc1ccc(C(=Cc2c[nH]c3ncccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-11(22)21-14-6-4-12(5-7-14)16(18(23)24)9-13-10-20-17-15(13)3-2-8-19-17/h2-10H,1H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | HARBYPKNGPDPFL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|