C17H11F3N2O2 — CID 18400612
(E)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 18400612) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is (E)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18400612 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (E)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1c[nH]c2ncccc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F3N2O2/c18-17(19,20)12-5-3-10(4-6-12)14(16(23)24)8-11-9-22-15-13(11)2-1-7-21-15/h1-9H,(H,21,22)(H,23,24)/b14-8+ |
| InChIKey | BGUUUKQQZCUDIF-RIYZIHGNSA-N |
| XLogP | 4.21 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|